C16H29NO — CID 114404456
4-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine (PubChem CID 114404456) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 4-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404456 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 4-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CC1CCC(C(C)C)C(OCC2=CCNCC2)C1 |
| InChI | InChI=1S/C16H29NO/c1-12(2)15-5-4-13(3)10-16(15)18-11-14-6-8-17-9-7-14/h6,12-13,15-17H,4-5,7-11H2,1-3H3 |
| InChIKey | FEUCNNCKWSQMDO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|