C10H19NO — CID 114404459
4-(2-methylpropoxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 114404459) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 4-(2-methylpropoxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2-methylpropoxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404459 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 4-(2-methylpropoxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | CC(C)COCC1=CCNCC1 |
| InChI | InChI=1S/C10H19NO/c1-9(2)7-12-8-10-3-5-11-6-4-10/h3,9,11H,4-8H2,1-2H3 |
| InChIKey | IWPSACHSYYMUFY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|