C11H21NO2 — CID 114404468
4-(2-propan-2-yloxyethoxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 114404468) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 4-(2-propan-2-yloxyethoxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2-propan-2-yloxyethoxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404468 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 4-(2-propan-2-yloxyethoxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | CC(C)OCCOCC1=CCNCC1 |
| InChI | InChI=1S/C11H21NO2/c1-10(2)14-8-7-13-9-11-3-5-12-6-4-11/h3,10,12H,4-9H2,1-2H3 |
| InChIKey | PUDLBKWXOPKQMC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|