C14H27NO — CID 114404541
4-(2-ethylhexoxymethyl)-1,2,3,6-tetrahydropyridine (PubChem CID 114404541) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-(2-ethylhexoxymethyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(2-ethylhexoxymethyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404541 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 4-(2-ethylhexoxymethyl)-1,2,3,6-tetrahydropyridine |
| SMILES | CCCCC(CC)COCC1=CCNCC1 |
| InChI | InChI=1S/C14H27NO/c1-3-5-6-13(4-2)11-16-12-14-7-9-15-10-8-14/h7,13,15H,3-6,8-12H2,1-2H3 |
| InChIKey | AFEQNISUQKGEPB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|