About [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate
[3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate (PubChem CID 11440517) has the molecular formula C25H20O4
and a molecular weight of 384.43 g/mol. Its IUPAC name is [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate |
| PubChem CID | 11440517 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate |
| SMILES | CC(COC(=O)c1ccc2ccccc2c1)CC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H20O4/c1-16(12-20-14-23(26)21-8-4-5-9-22(21)24(20)27)15-29-25(28)19-11-10-17-6-2-3-7-18(17)13-19/h2-11,13-14,16H,12,15H2,1H3 |
| InChIKey | HANHTDHLQMHGRK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate?
The IUPAC name of [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate (CID 11440517) is [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate.
What is the SMILES notation for [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate?
The canonical SMILES for [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate is CC(COC(=O)c1ccc2ccccc2c1)CC1=CC(=O)c2ccccc2C1=O.
What is the InChIKey of [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate?
The InChIKey is HANHTDHLQMHGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O4/c1-16(12-20-14-23(26)21-8-4-5-9-22(21)24(20)27)15-29-25(28)19-11-10-17-6-2-3-7-18(17)13-19/h2-11,13-14,16H,12,15H2,1H3.
What are the key properties of [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate?
[3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate has a molecular weight of 384.43 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,4-dioxonaphthalen-2-yl)-2-methylpropyl] naphthalene-2-carboxylate is sourced from PubChem (CID 11440517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).