C22H22N6O — CID 11440570
9-[(5-methyl-1H-imidazol-2-yl)methoxy]-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene (PubChem CID 11440570) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 9-[(5-methyl-1H-imidazol-2-yl)methoxy]-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene.
| Compound Name | 9-[(5-methyl-1H-imidazol-2-yl)methoxy]-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
|---|---|
| PubChem CID | 11440570 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 9-[(5-methyl-1H-imidazol-2-yl)methoxy]-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
| SMILES | Cc1cnc(COc2nn3c(-c4ccccc4)nnc3c3c2C2CCC3CC2)[nH]1 |
| InChI | InChI=1S/C22H22N6O/c1-13-11-23-17(24-13)12-29-22-19-15-9-7-14(8-10-15)18(19)21-26-25-20(28(21)27-22)16-5-3-2-4-6-16/h2-6,11,14-15H,7-10,12H2,1H3,(H,23,24) |
| InChIKey | ZAKVPALBELHKFH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |