C25H30N4 — CID 11440577
5-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]-2H-tetrazole (PubChem CID 11440577) has the molecular formula C25H30N4 and a molecular weight of 386.54 g/mol. Its IUPAC name is 5-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]-2H-tetrazole.
| Compound Name | 5-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 11440577 |
| Molecular Formula | C25H30N4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 5-[[4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]methyl]-2H-tetrazole |
| SMILES | C=C(c1ccc(Cc2nn[nH]n2)cc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H30N4/c1-16-13-21-22(25(5,6)12-11-24(21,3)4)15-20(16)17(2)19-9-7-18(8-10-19)14-23-26-28-29-27-23/h7-10,13,15H,2,11-12,14H2,1,3-6H3,(H,26,27,28,29) |
| InChIKey | NULLKKGMMYYSPR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |