C24H38N2O2 — CID 11440581
3-[1-[3-(1-methoxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]benzamide (PubChem CID 11440581) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is 3-[1-[3-(1-methoxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]benzamide.
| Compound Name | 3-[1-[3-(1-methoxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 11440581 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 3-[1-[3-(1-methoxycyclohexyl)propyl]-3,4-dimethylpiperidin-4-yl]benzamide |
| SMILES | COC1(CCCN2CCC(C)(c3cccc(C(N)=O)c3)C(C)C2)CCCCC1 |
| InChI | InChI=1S/C24H38N2O2/c1-19-18-26(15-8-13-24(28-3)11-5-4-6-12-24)16-14-23(19,2)21-10-7-9-20(17-21)22(25)27/h7,9-10,17,19H,4-6,8,11-16,18H2,1-3H3,(H2,25,27) |
| InChIKey | LDJWFNFHYIGWME-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |