C14H20N4O3 — CID 114406024
methyl 5-amino-6-[4-(2-amino-2-oxoethyl)piperidin-1-yl]pyridine-2-carboxylate (PubChem CID 114406024) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 5-amino-6-[4-(2-amino-2-oxoethyl)piperidin-1-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-amino-6-[4-(2-amino-2-oxoethyl)piperidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 114406024 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl 5-amino-6-[4-(2-amino-2-oxoethyl)piperidin-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(N)c(N2CCC(CC(N)=O)CC2)n1 |
| InChI | InChI=1S/C14H20N4O3/c1-21-14(20)11-3-2-10(15)13(17-11)18-6-4-9(5-7-18)8-12(16)19/h2-3,9H,4-8,15H2,1H3,(H2,16,19) |
| InChIKey | MVHVCLCZZNMAMS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |