About bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium
bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium (PubChem CID 11440619) has the molecular formula C9H10F6N2O4S2
and a molecular weight of 388.31 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium |
| PubChem CID | 11440619 |
| Molecular Formula | C9H10F6N2O4S2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium |
| SMILES | CC[n+]1ccccc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10N.C2F6NO4S2/c1-2-8-6-4-3-5-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-7H,2H2,1H3;/q+1;-1 |
| InChIKey | GNWJDYQCOZNHPC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium (CID 11440619) is bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium is CC[n+]1ccccc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium?
The InChIKey is GNWJDYQCOZNHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N.C2F6NO4S2/c1-2-8-6-4-3-5-7-8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-7H,2H2,1H3;/q+1;-1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium?
bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium has a molecular weight of 388.31 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;1-ethylpyridin-1-ium is sourced from PubChem (CID 11440619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).