C12H14N6O — CID 114406194
5-amino-6-[(2-methylpyrimidin-4-yl)methylamino]pyridine-2-carboxamide (PubChem CID 114406194) has the molecular formula C12H14N6O and a molecular weight of 258.29 g/mol. Its IUPAC name is 5-amino-6-[(2-methylpyrimidin-4-yl)methylamino]pyridine-2-carboxamide.
| Compound Name | 5-amino-6-[(2-methylpyrimidin-4-yl)methylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114406194 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-amino-6-[(2-methylpyrimidin-4-yl)methylamino]pyridine-2-carboxamide |
| SMILES | Cc1nccc(CNc2nc(C(N)=O)ccc2N)n1 |
| InChI | InChI=1S/C12H14N6O/c1-7-15-5-4-8(17-7)6-16-12-9(13)2-3-10(18-12)11(14)19/h2-5H,6,13H2,1H3,(H2,14,19)(H,16,18) |
| InChIKey | YOVINFLNKNHJLU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |