About 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid
5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid (PubChem CID 114407308) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid |
| PubChem CID | 114407308 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid |
| SMILES | CC1CC(Nc2nc(C(=O)O)ccc2N)CCN1C |
| InChI | InChI=1S/C13H20N4O2/c1-8-7-9(5-6-17(8)2)15-12-10(14)3-4-11(16-12)13(18)19/h3-4,8-9H,5-7,14H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | RAUGPMYCUNFTMS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid?
The IUPAC name of 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid (CID 114407308) is 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid?
The canonical SMILES for 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid is CC1CC(Nc2nc(C(=O)O)ccc2N)CCN1C.
What is the InChIKey of 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid?
The InChIKey is RAUGPMYCUNFTMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-8-7-9(5-6-17(8)2)15-12-10(14)3-4-11(16-12)13(18)19/h3-4,8-9H,5-7,14H2,1-2H3,(H,15,16)(H,18,19).
What are the key properties of 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid?
5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid has a molecular weight of 264.33 g/mol, XLogP of 1.26, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-[(1,2-dimethylpiperidin-4-yl)amino]pyridine-2-carboxylic acid is sourced from PubChem (CID 114407308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).