C21H28O7 — CID 11440758
methyl (E,5S)-5-[(2R,4aR,6S,7R,8aS)-7-hydroxy-4a,6-dimethyl-2-phenyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-hydroxypent-2-enoate (PubChem CID 11440758) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is methyl (E,5S)-5-[(2R,4aR,6S,7R,8aS)-7-hydroxy-4a,6-dimethyl-2-phenyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-hydroxypent-2-enoate.
| Compound Name | methyl (E,5S)-5-[(2R,4aR,6S,7R,8aS)-7-hydroxy-4a,6-dimethyl-2-phenyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-hydroxypent-2-enoate |
|---|---|
| PubChem CID | 11440758 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | methyl (E,5S)-5-[(2R,4aR,6S,7R,8aS)-7-hydroxy-4a,6-dimethyl-2-phenyl-4,7,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-5-hydroxypent-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H](O)[C@]1(C)O[C@]2(C)CO[C@@H](c3ccccc3)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H28O7/c1-20-13-26-19(14-8-5-4-6-9-14)27-17(20)12-16(23)21(2,28-20)15(22)10-7-11-18(24)25-3/h4-9,11,15-17,19,22-23H,10,12-13H2,1-3H3/b11-7+/t15-,16+,17-,19+,20+,21-/m0/s1 |
| InChIKey | YVACUTIZKQLEHH-WUTUONJESA-N |
| XLogP | 1.88 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|