C23H26N2O4 — CID 11440814
[(8Z)-11-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 11440814) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [(8Z)-11-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | [(8Z)-11-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 11440814 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [(8Z)-11-acetyloxy-5,6,7,10,11,12-hexahydrobenzo[10]annulen-6-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | CC(=O)OC1C/C=C\CC(OC(=O)/C=C/c2cn(C)cn2)Cc2ccccc2C1 |
| InChI | InChI=1S/C23H26N2O4/c1-17(26)28-21-9-5-6-10-22(14-19-8-4-3-7-18(19)13-21)29-23(27)12-11-20-15-25(2)16-24-20/h3-8,11-12,15-16,21-22H,9-10,13-14H2,1-2H3/b6-5-,12-11+ |
| InChIKey | XUZGINAAKPPBMZ-OXHHXQHLSA-N |
| XLogP | 3.41 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|