About 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one
2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one (PubChem CID 114408789) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one |
| PubChem CID | 114408789 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one |
| SMILES | COCC(N)C(=O)N1CC=CCC1 |
| InChI | InChI=1S/C9H16N2O2/c1-13-7-8(10)9(12)11-5-3-2-4-6-11/h2-3,8H,4-7,10H2,1H3 |
| InChIKey | DPHOCBQCKQENPK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one?
The IUPAC name of 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one (CID 114408789) is 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one.
What is the SMILES notation for 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one?
The canonical SMILES for 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one is COCC(N)C(=O)N1CC=CCC1.
What is the InChIKey of 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one?
The InChIKey is DPHOCBQCKQENPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-13-7-8(10)9(12)11-5-3-2-4-6-11/h2-3,8H,4-7,10H2,1H3.
What are the key properties of 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one?
2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one has a molecular weight of 184.24 g/mol, XLogP of -0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(3,6-dihydro-2H-pyridin-1-yl)-3-methoxypropan-1-one is sourced from PubChem (CID 114408789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).