C11H18N2O2 — CID 114409009
1-(3,6-dihydro-2H-pyridin-1-yl)-2-morpholin-2-ylethanone (PubChem CID 114409009) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)-2-morpholin-2-ylethanone.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-morpholin-2-ylethanone |
|---|---|
| PubChem CID | 114409009 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-morpholin-2-ylethanone |
| SMILES | O=C(CC1CNCCO1)N1CC=CCC1 |
| InChI | InChI=1S/C11H18N2O2/c14-11(13-5-2-1-3-6-13)8-10-9-12-4-7-15-10/h1-2,10,12H,3-9H2 |
| InChIKey | VHPFRWAQUIZJSC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|