C8H9F2N3O2 — CID 114409165
5-amino-6-(2,2-difluoroethoxy)pyridine-2-carboxamide (PubChem CID 114409165) has the molecular formula C8H9F2N3O2 and a molecular weight of 217.18 g/mol. Its IUPAC name is 5-amino-6-(2,2-difluoroethoxy)pyridine-2-carboxamide.
| Compound Name | 5-amino-6-(2,2-difluoroethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114409165 |
| Molecular Formula | C8H9F2N3O2 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-amino-6-(2,2-difluoroethoxy)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N)c(OCC(F)F)n1 |
| InChI | InChI=1S/C8H9F2N3O2/c9-6(10)3-15-8-4(11)1-2-5(13-8)7(12)14/h1-2,6H,3,11H2,(H2,12,14) |
| InChIKey | TYIVBWLNTUBVOG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |