About 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide
5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide (PubChem CID 114409315) has the molecular formula C8H8N6OS
and a molecular weight of 236.26 g/mol. Its IUPAC name is 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide |
| PubChem CID | 114409315 |
| Molecular Formula | C8H8N6OS |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(N)c(Sc2ncn[nH]2)n1 |
| InChI | InChI=1S/C8H8N6OS/c9-4-1-2-5(6(10)15)13-7(4)16-8-11-3-12-14-8/h1-3H,9H2,(H2,10,15)(H,11,12,14) |
| InChIKey | SROZDPQQHSDSJC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide?
The IUPAC name of 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide (CID 114409315) is 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide.
What is the SMILES notation for 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide?
The canonical SMILES for 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide is NC(=O)c1ccc(N)c(Sc2ncn[nH]2)n1.
What is the InChIKey of 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide?
The InChIKey is SROZDPQQHSDSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6OS/c9-4-1-2-5(6(10)15)13-7(4)16-8-11-3-12-14-8/h1-3H,9H2,(H2,10,15)(H,11,12,14).
What are the key properties of 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide?
5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide has a molecular weight of 236.26 g/mol, XLogP of 0.03, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide is sourced from PubChem (CID 114409315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).