C11H19N3O3 — CID 114409712
2-amino-N-[2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]acetamide (PubChem CID 114409712) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-amino-N-[2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 114409712 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-amino-N-[2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]acetamide |
| SMILES | COCC1=CCN(C(=O)CNC(=O)CN)CC1 |
| InChI | InChI=1S/C11H19N3O3/c1-17-8-9-2-4-14(5-3-9)11(16)7-13-10(15)6-12/h2H,3-8,12H2,1H3,(H,13,15) |
| InChIKey | RCFPMEJIQQSIOH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|