C16H28N2O2 — CID 114409780
[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3-propylpiperidin-3-yl)methanone (PubChem CID 114409780) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is [4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3-propylpiperidin-3-yl)methanone.
| Compound Name | [4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3-propylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 114409780 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | [4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-(3-propylpiperidin-3-yl)methanone |
| SMILES | CCCC1(C(=O)N2CC=C(COC)CC2)CCCNC1 |
| InChI | InChI=1S/C16H28N2O2/c1-3-7-16(8-4-9-17-13-16)15(19)18-10-5-14(6-11-18)12-20-2/h5,17H,3-4,6-13H2,1-2H3 |
| InChIKey | OKWREZYSBIFISA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|