C22H28O5Si — CID 11440980
(3R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxyoxan-2-one (PubChem CID 11440980) has the molecular formula C22H28O5Si and a molecular weight of 400.55 g/mol. Its IUPAC name is (3R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxyoxan-2-one.
| Compound Name | (3R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxyoxan-2-one |
|---|---|
| PubChem CID | 11440980 |
| Molecular Formula | C22H28O5Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (3R,4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxyoxan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](O)[C@@H](O)C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O5Si/c1-22(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-15-16-14-19(23)20(24)21(25)27-16/h4-13,16,19-20,23-24H,14-15H2,1-3H3/t16-,19+,20+/m0/s1 |
| InChIKey | KFFULZOOUVUKTA-PWIZWCRZSA-N |
| XLogP | 1.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|