About 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile
3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile (PubChem CID 114409975) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile.
Molecular Properties
| Compound Name | 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile |
| PubChem CID | 114409975 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile |
| SMILES | COCC1=CCN(C(=O)C(C)C#N)CC1 |
| InChI | InChI=1S/C11H16N2O2/c1-9(7-12)11(14)13-5-3-10(4-6-13)8-15-2/h3,9H,4-6,8H2,1-2H3 |
| InChIKey | AGXMBFUXIOSLFR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile?
The IUPAC name of 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile (CID 114409975) is 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile.
What is the SMILES notation for 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile?
The canonical SMILES for 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile is COCC1=CCN(C(=O)C(C)C#N)CC1.
What is the InChIKey of 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile?
The InChIKey is AGXMBFUXIOSLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-9(7-12)11(14)13-5-3-10(4-6-13)8-15-2/h3,9H,4-6,8H2,1-2H3.
What are the key properties of 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile?
3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile has a molecular weight of 208.26 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-methyl-3-oxopropanenitrile is sourced from PubChem (CID 114409975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).