About 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine
1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 114410666) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine |
| PubChem CID | 114410666 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | CCC1(CN2CC=CCC2)CCNC1 |
| InChI | InChI=1S/C12H22N2/c1-2-12(6-7-13-10-12)11-14-8-4-3-5-9-14/h3-4,13H,2,5-11H2,1H3 |
| InChIKey | HQRMPUOXQVXFNZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine (CID 114410666) is 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine is CCC1(CN2CC=CCC2)CCNC1.
What is the InChIKey of 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine?
The InChIKey is HQRMPUOXQVXFNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-2-12(6-7-13-10-12)11-14-8-4-3-5-9-14/h3-4,13H,2,5-11H2,1H3.
What are the key properties of 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine?
1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine has a molecular weight of 194.32 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-ethylpyrrolidin-3-yl)methyl]-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 114410666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).