C11H20N2O — CID 114410741
3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]morpholine (PubChem CID 114410741) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]morpholine.
| Compound Name | 3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]morpholine |
|---|---|
| PubChem CID | 114410741 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]morpholine |
| SMILES | CC1=CCN(CC2COCCN2)CC1 |
| InChI | InChI=1S/C11H20N2O/c1-10-2-5-13(6-3-10)8-11-9-14-7-4-12-11/h2,11-12H,3-9H2,1H3 |
| InChIKey | SXNXHSNVIKHSGC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|