C12H22N2O2 — CID 114410947
3-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]morpholine (PubChem CID 114410947) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]morpholine.
| Compound Name | 3-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]morpholine |
|---|---|
| PubChem CID | 114410947 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]morpholine |
| SMILES | COCC1=CCN(CC2COCCN2)CC1 |
| InChI | InChI=1S/C12H22N2O2/c1-15-9-11-2-5-14(6-3-11)8-12-10-16-7-4-13-12/h2,12-13H,3-10H2,1H3 |
| InChIKey | DFKUIKRHMOARJR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|