C15H30N2O — CID 114411035
7-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-6-methylheptan-2-amine (PubChem CID 114411035) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 7-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-6-methylheptan-2-amine.
| Compound Name | 7-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-6-methylheptan-2-amine |
|---|---|
| PubChem CID | 114411035 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 7-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-6-methylheptan-2-amine |
| SMILES | COCC1=CCN(CC(C)CCCC(C)N)CC1 |
| InChI | InChI=1S/C15H30N2O/c1-13(5-4-6-14(2)16)11-17-9-7-15(8-10-17)12-18-3/h7,13-14H,4-6,8-12,16H2,1-3H3 |
| InChIKey | HEPCRXUEMSMABG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|