About 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine
4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine (PubChem CID 114411057) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine.
Molecular Properties
| Compound Name | 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine |
| PubChem CID | 114411057 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine |
| SMILES | CNCCCCN1CC=C(COC)CC1 |
| InChI | InChI=1S/C12H24N2O/c1-13-7-3-4-8-14-9-5-12(6-10-14)11-15-2/h5,13H,3-4,6-11H2,1-2H3 |
| InChIKey | CMSJANNRTKWWKO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine?
The IUPAC name of 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine (CID 114411057) is 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine.
What is the SMILES notation for 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine?
The canonical SMILES for 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine is CNCCCCN1CC=C(COC)CC1.
What is the InChIKey of 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine?
The InChIKey is CMSJANNRTKWWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-13-7-3-4-8-14-9-5-12(6-10-14)11-15-2/h5,13H,3-4,6-11H2,1-2H3.
What are the key properties of 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine?
4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine has a molecular weight of 212.34 g/mol, XLogP of 1.26, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylbutan-1-amine is sourced from PubChem (CID 114411057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).