About [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol
[3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol (PubChem CID 114411346) has the molecular formula C12H14ClNO
and a molecular weight of 223.70 g/mol. Its IUPAC name is [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol |
| PubChem CID | 114411346 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol |
| SMILES | OCc1ccc(N2CC=CCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClNO/c13-11-8-10(9-15)4-5-12(11)14-6-2-1-3-7-14/h1-2,4-5,8,15H,3,6-7,9H2 |
| InChIKey | SWNJQXFXOKKLHH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol?
The IUPAC name of [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol (CID 114411346) is [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol.
What is the SMILES notation for [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol?
The canonical SMILES for [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol is OCc1ccc(N2CC=CCC2)c(Cl)c1.
What is the InChIKey of [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol?
The InChIKey is SWNJQXFXOKKLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClNO/c13-11-8-10(9-15)4-5-12(11)14-6-2-1-3-7-14/h1-2,4-5,8,15H,3,6-7,9H2.
What are the key properties of [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol?
[3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol has a molecular weight of 223.70 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-4-(3,6-dihydro-2H-pyridin-1-yl)phenyl]methanol is sourced from PubChem (CID 114411346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).