About [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol
[2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol (PubChem CID 114411420) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol |
| PubChem CID | 114411420 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol |
| SMILES | COCC1=CCN(c2ncc(CO)cn2)CC1 |
| InChI | InChI=1S/C12H17N3O2/c1-17-9-10-2-4-15(5-3-10)12-13-6-11(8-16)7-14-12/h2,6-7,16H,3-5,8-9H2,1H3 |
| InChIKey | GGTHFDMRTRVISM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol?
The IUPAC name of [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol (CID 114411420) is [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol.
What is the SMILES notation for [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol?
The canonical SMILES for [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol is COCC1=CCN(c2ncc(CO)cn2)CC1.
What is the InChIKey of [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol?
The InChIKey is GGTHFDMRTRVISM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-17-9-10-2-4-15(5-3-10)12-13-6-11(8-16)7-14-12/h2,6-7,16H,3-5,8-9H2,1H3.
What are the key properties of [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol?
[2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol has a molecular weight of 235.29 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrimidin-5-yl]methanol is sourced from PubChem (CID 114411420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).