C16H20N2O3 — CID 114411783
4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-phenylbutanoic acid (PubChem CID 114411783) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-phenylbutanoic acid.
| Compound Name | 4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 114411783 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(NC(=O)N1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c19-15(20)10-9-14(13-7-3-1-4-8-13)17-16(21)18-11-5-2-6-12-18/h1-5,7-8,14H,6,9-12H2,(H,17,21)(H,19,20) |
| InChIKey | QQHPXUBHMNHIBR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|