C14H22N2O3 — CID 114411790
2-[1-(3,6-dihydro-2H-pyridine-1-carbonylamino)cyclohexyl]acetic acid (PubChem CID 114411790) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[1-(3,6-dihydro-2H-pyridine-1-carbonylamino)cyclohexyl]acetic acid.
| Compound Name | 2-[1-(3,6-dihydro-2H-pyridine-1-carbonylamino)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 114411790 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[1-(3,6-dihydro-2H-pyridine-1-carbonylamino)cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)N2CC=CCC2)CCCCC1 |
| InChI | InChI=1S/C14H22N2O3/c17-12(18)11-14(7-3-1-4-8-14)15-13(19)16-9-5-2-6-10-16/h2,5H,1,3-4,6-11H2,(H,15,19)(H,17,18) |
| InChIKey | IEYSBCQKSBBYRM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|