C14H22N2O4 — CID 114412142
2-[cyclopropylmethyl-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]acetic acid (PubChem CID 114412142) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 114412142 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[cyclopropylmethyl-[4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]acetic acid |
| SMILES | COCC1=CCN(C(=O)N(CC(=O)O)CC2CC2)CC1 |
| InChI | InChI=1S/C14H22N2O4/c1-20-10-12-4-6-15(7-5-12)14(19)16(9-13(17)18)8-11-2-3-11/h4,11H,2-3,5-10H2,1H3,(H,17,18) |
| InChIKey | AKSTTWRXESTTJA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|