C11H14N4O — CID 114412324
(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114412324) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is (5-cyclopropyl-1H-1,2,4-triazol-3-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (5-cyclopropyl-1H-1,2,4-triazol-3-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114412324 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (5-cyclopropyl-1H-1,2,4-triazol-3-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1n[nH]c(C2CC2)n1)N1CC=CCC1 |
| InChI | InChI=1S/C11H14N4O/c16-11(15-6-2-1-3-7-15)10-12-9(13-14-10)8-4-5-8/h1-2,8H,3-7H2,(H,12,13,14) |
| InChIKey | OBTHSIISRIGDRA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|