C12H17N3 — CID 114412650
[4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanamine (PubChem CID 114412650) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is [4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanamine.
| Compound Name | [4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114412650 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | [4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-pyridinyl]methanamine |
| SMILES | CC1=CCN(c2ccnc(CN)c2)CC1 |
| InChI | InChI=1S/C12H17N3/c1-10-3-6-15(7-4-10)12-2-5-14-11(8-12)9-13/h2-3,5,8H,4,6-7,9,13H2,1H3 |
| InChIKey | NTPAYPZAKRBCHT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|