C15H16F3N5O — CID 11441300
(3R)-3-amino-1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 11441300) has the molecular formula C15H16F3N5O and a molecular weight of 339.32 g/mol. Its IUPAC name is (3R)-3-amino-1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 11441300 |
| Molecular Formula | C15H16F3N5O |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (3R)-3-amino-1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCn2cnnc2C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H16F3N5O/c16-11-6-13(18)12(17)4-9(11)3-10(19)5-15(24)22-1-2-23-8-20-21-14(23)7-22/h4,6,8,10H,1-3,5,7,19H2/t10-/m1/s1 |
| InChIKey | KJXVBDNOXKGFEH-SNVBAGLBSA-N |
| XLogP | 1.00 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|