C24H23N5O2 — CID 11441346
6-(3-methoxyphenyl)-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene (PubChem CID 11441346) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene.
| Compound Name | 6-(3-methoxyphenyl)-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
|---|---|
| PubChem CID | 11441346 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 6-(3-methoxyphenyl)-9-(pyridin-2-ylmethoxy)-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
| SMILES | COc1cccc(-c2nnc3c4c(c(OCc5ccccn5)nn23)C2CCC4CC2)c1 |
| InChI | InChI=1S/C24H23N5O2/c1-30-19-7-4-5-17(13-19)22-26-27-23-20-15-8-10-16(11-9-15)21(20)24(28-29(22)23)31-14-18-6-2-3-12-25-18/h2-7,12-13,15-16H,8-11,14H2,1H3 |
| InChIKey | HOXKKBLQXUBSEI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |