About 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine
6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine (PubChem CID 114413561) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine.
Molecular Properties
| Compound Name | 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine |
| PubChem CID | 114413561 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine |
| SMILES | CNCCCCCCN1CC=C(COC)CC1 |
| InChI | InChI=1S/C14H28N2O/c1-15-9-5-3-4-6-10-16-11-7-14(8-12-16)13-17-2/h7,15H,3-6,8-13H2,1-2H3 |
| InChIKey | QAHBHGLDWMFITB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine?
The IUPAC name of 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine (CID 114413561) is 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine.
What is the SMILES notation for 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine?
The canonical SMILES for 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine is CNCCCCCCN1CC=C(COC)CC1.
What is the InChIKey of 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine?
The InChIKey is QAHBHGLDWMFITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O/c1-15-9-5-3-4-6-10-16-11-7-14(8-12-16)13-17-2/h7,15H,3-6,8-13H2,1-2H3.
What are the key properties of 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine?
6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine has a molecular weight of 240.39 g/mol, XLogP of 2.04, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-N-methylhexan-1-amine is sourced from PubChem (CID 114413561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).