About (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide
(E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide (PubChem CID 11441413) has the molecular formula C27H29NO3
and a molecular weight of 415.53 g/mol. Its IUPAC name is (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide.
Molecular Properties
| Compound Name | (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide |
| PubChem CID | 11441413 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide |
| SMILES | CON(C)C(=O)/C=C/[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-22(19-20-26(29)28(2)30-3)21-31-27(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-20,22H,21H2,1-3H3/b20-19+/t22-/m1/s1 |
| InChIKey | FSRSIMFABZUNFX-YVHXKWHWSA-N |
| XLogP | 5.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide?
The IUPAC name of (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide (CID 11441413) is (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide.
What is the SMILES notation for (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide?
The canonical SMILES for (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide is CON(C)C(=O)/C=C/[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide?
The InChIKey is FSRSIMFABZUNFX-YVHXKWHWSA-N. The full InChI is InChI=1S/C27H29NO3/c1-22(19-20-26(29)28(2)30-3)21-31-27(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-20,22H,21H2,1-3H3/b20-19+/t22-/m1/s1.
What are the key properties of (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide?
(E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide has a molecular weight of 415.53 g/mol, XLogP of 5.21, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4R)-N-methoxy-N,4-dimethyl-5-trityloxypent-2-enamide is sourced from PubChem (CID 11441413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).