C13H21N3O2S — CID 114414356
[1-ethyl-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrrol-2-yl]methanamine (PubChem CID 114414356) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is [1-ethyl-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrrol-2-yl]methanamine.
| Compound Name | [1-ethyl-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrrol-2-yl]methanamine |
|---|---|
| PubChem CID | 114414356 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [1-ethyl-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]pyrrol-2-yl]methanamine |
| SMILES | CCn1cc(S(=O)(=O)N2CC=C(C)CC2)cc1CN |
| InChI | InChI=1S/C13H21N3O2S/c1-3-15-10-13(8-12(15)9-14)19(17,18)16-6-4-11(2)5-7-16/h4,8,10H,3,5-7,9,14H2,1-2H3 |
| InChIKey | MULWFTGUDMJKQV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|