C8H10N4O — CID 114414627
4-amino-N-but-3-yn-2-yl-1H-pyrazole-5-carboxamide (PubChem CID 114414627) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-amino-N-but-3-yn-2-yl-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-but-3-yn-2-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 114414627 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-amino-N-but-3-yn-2-yl-1H-pyrazole-5-carboxamide |
| SMILES | C#CC(C)NC(=O)c1[nH]ncc1N |
| InChI | InChI=1S/C8H10N4O/c1-3-5(2)11-8(13)7-6(9)4-10-12-7/h1,4-5H,9H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | QGXGJOATADNONS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|