C22H21N3O6 — CID 11441631
(4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 11441631) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11441631 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (4S)-4-benzyl-5,5-dimethyl-3-[(5S)-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C(=O)[C@@H]2CC(c3ccc([N+](=O)[O-])cc3)=NO2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H21N3O6/c1-22(2)19(12-14-6-4-3-5-7-14)24(21(27)30-22)20(26)18-13-17(23-31-18)15-8-10-16(11-9-15)25(28)29/h3-11,18-19H,12-13H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | ORCFXVGTQOWCAB-OALUTQOASA-N |
| XLogP | 3.46 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|