C11H8ClFN4O4 — CID 114416610
2-chloro-4-(2-fluoro-5-methyl-4-nitrophenoxy)-6-methoxy-1,3,5-triazine (PubChem CID 114416610) has the molecular formula C11H8ClFN4O4 and a molecular weight of 314.66 g/mol. Its IUPAC name is 2-chloro-4-(2-fluoro-5-methyl-4-nitrophenoxy)-6-methoxy-1,3,5-triazine.
| Compound Name | 2-chloro-4-(2-fluoro-5-methyl-4-nitrophenoxy)-6-methoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 114416610 |
| Molecular Formula | C11H8ClFN4O4 |
| Molecular Weight | 314.66 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-chloro-4-(2-fluoro-5-methyl-4-nitrophenoxy)-6-methoxy-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(Oc2cc(C)c([N+](=O)[O-])cc2F)n1 |
| InChI | InChI=1S/C11H8ClFN4O4/c1-5-3-8(6(13)4-7(5)17(18)19)21-11-15-9(12)14-10(16-11)20-2/h3-4H,1-2H3 |
| InChIKey | QXKVYHUZPFWAQF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|