C10H14N2O — CID 114417006
2-(azetidin-3-ylidene)-N-but-3-yn-2-ylpropanamide (PubChem CID 114417006) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-but-3-yn-2-ylpropanamide.
| Compound Name | 2-(azetidin-3-ylidene)-N-but-3-yn-2-ylpropanamide |
|---|---|
| PubChem CID | 114417006 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-but-3-yn-2-ylpropanamide |
| SMILES | C#CC(C)NC(=O)C(C)=C1CNC1 |
| InChI | InChI=1S/C10H14N2O/c1-4-7(2)12-10(13)8(3)9-5-11-6-9/h1,7,11H,5-6H2,2-3H3,(H,12,13) |
| InChIKey | AJLYICHLKQCZEF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|