C11H20N2O — CID 114417192
3-amino-N-but-3-yn-2-yl-2,2,3-trimethylbutanamide (PubChem CID 114417192) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-amino-N-but-3-yn-2-yl-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-but-3-yn-2-yl-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 114417192 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-amino-N-but-3-yn-2-yl-2,2,3-trimethylbutanamide |
| SMILES | C#CC(C)NC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C11H20N2O/c1-7-8(2)13-9(14)10(3,4)11(5,6)12/h1,8H,12H2,2-6H3,(H,13,14) |
| InChIKey | TUNPCKUOHQBHJE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|