C13H16N2O — CID 114417205
4-(2-aminoethyl)-N-but-3-yn-2-ylbenzamide (PubChem CID 114417205) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-but-3-yn-2-ylbenzamide.
| Compound Name | 4-(2-aminoethyl)-N-but-3-yn-2-ylbenzamide |
|---|---|
| PubChem CID | 114417205 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-(2-aminoethyl)-N-but-3-yn-2-ylbenzamide |
| SMILES | C#CC(C)NC(=O)c1ccc(CCN)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-3-10(2)15-13(16)12-6-4-11(5-7-12)8-9-14/h1,4-7,10H,8-9,14H2,2H3,(H,15,16) |
| InChIKey | YXQGDKKRUUYFQL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|