C13H10Cl3N3O7 — CID 11441721
ethyl 6-nitro-1-(2,2,2-trichloroethoxycarbonyloxy)benzimidazole-2-carboxylate (PubChem CID 11441721) has the molecular formula C13H10Cl3N3O7 and a molecular weight of 426.60 g/mol. Its IUPAC name is ethyl 6-nitro-1-(2,2,2-trichloroethoxycarbonyloxy)benzimidazole-2-carboxylate.
| Compound Name | ethyl 6-nitro-1-(2,2,2-trichloroethoxycarbonyloxy)benzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 11441721 |
| Molecular Formula | C13H10Cl3N3O7 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | ethyl 6-nitro-1-(2,2,2-trichloroethoxycarbonyloxy)benzimidazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccc([N+](=O)[O-])cc2n1OC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H10Cl3N3O7/c1-2-24-11(20)10-17-8-4-3-7(19(22)23)5-9(8)18(10)26-12(21)25-6-13(14,15)16/h3-5H,2,6H2,1H3 |
| InChIKey | WTPZUTFMQAAGEV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 122.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|