About CID 11441758
CID 11441758 (PubChem CID 11441758) has the molecular formula C19H21NO4Ru+2
and a molecular weight of 428.45 g/mol.
Molecular Properties
| Compound Name | CID 11441758 |
| PubChem CID | 11441758 |
| Molecular Formula | C19H21NO4Ru+2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | — |
| SMILES | CO/C(C)=C1/C(=O)N(C)CC12[CH][CH][C]1OCO[C]1[CH]2.[CH]1[CH][CH][CH][CH]1.[Ru+2] |
| InChI | InChI=1S/C14H16NO4.C5H5.Ru/c1-9(17-3)12-13(16)15(2)7-14(12)5-4-10-11(6-14)19-8-18-10;1-2-4-5-3-1;/h4-6H,7-8H2,1-3H3;1-5H;/q;;+2/b12-9-;; |
| InChIKey | NABCVDVCGSCDGP-AGZDHKJJSA-N |
| XLogP | 2.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11441758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11441758?
The IUPAC name of CID 11441758 (CID 11441758) is not available.
What is the SMILES notation for CID 11441758?
The canonical SMILES for CID 11441758 is CO/C(C)=C1/C(=O)N(C)CC12[CH][CH][C]1OCO[C]1[CH]2.[CH]1[CH][CH][CH][CH]1.[Ru+2].
What is the InChIKey of CID 11441758?
The InChIKey is NABCVDVCGSCDGP-AGZDHKJJSA-N. The full InChI is InChI=1S/C14H16NO4.C5H5.Ru/c1-9(17-3)12-13(16)15(2)7-14(12)5-4-10-11(6-14)19-8-18-10;1-2-4-5-3-1;/h4-6H,7-8H2,1-3H3;1-5H;/q;;+2/b12-9-;;.
What are the key properties of CID 11441758?
CID 11441758 has a molecular weight of 428.45 g/mol, XLogP of 2.08, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11441758 is sourced from PubChem (CID 11441758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).