C12H9Br2FN2O — CID 114417661
4-[(3,5-dibromo-2-pyridinyl)oxy]-5-fluoro-2-methylaniline (PubChem CID 114417661) has the molecular formula C12H9Br2FN2O and a molecular weight of 376.02 g/mol. Its IUPAC name is 4-[(3,5-dibromo-2-pyridinyl)oxy]-5-fluoro-2-methylaniline.
| Compound Name | 4-[(3,5-dibromo-2-pyridinyl)oxy]-5-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 114417661 |
| Molecular Formula | C12H9Br2FN2O |
| Molecular Weight | 376.02 g/mol |
| Exact Mass | 373.91 |
| IUPAC Name | 4-[(3,5-dibromo-2-pyridinyl)oxy]-5-fluoro-2-methylaniline |
| SMILES | Cc1cc(Oc2ncc(Br)cc2Br)c(F)cc1N |
| InChI | InChI=1S/C12H9Br2FN2O/c1-6-2-11(9(15)4-10(6)16)18-12-8(14)3-7(13)5-17-12/h2-5H,16H2,1H3 |
| InChIKey | GKOHOVTVLRSSHS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|