C23H48O3Si2 — CID 11441774
(E,4R,5S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-5-trimethylsilyloxydec-2-enal (PubChem CID 11441774) has the molecular formula C23H48O3Si2 and a molecular weight of 428.81 g/mol. Its IUPAC name is (E,4R,5S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-5-trimethylsilyloxydec-2-enal.
| Compound Name | (E,4R,5S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-5-trimethylsilyloxydec-2-enal |
|---|---|
| PubChem CID | 11441774 |
| Molecular Formula | C23H48O3Si2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | (E,4R,5S,6S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-5-trimethylsilyloxydec-2-enal |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O[Si](C)(C)C)[C@H](C)/C=C(\C)C=O |
| InChI | InChI=1S/C23H48O3Si2/c1-14-18(3)21(26-28(12,13)23(6,7)8)20(5)22(25-27(9,10)11)19(4)15-17(2)16-24/h15-16,18-22H,14H2,1-13H3/b17-15+/t18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | KJLWYGGTCNFCNQ-JWLRHSHHSA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|