About 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane
2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane (PubChem CID 11441832) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane.
Molecular Properties
| Compound Name | 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane |
| PubChem CID | 11441832 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane |
| SMILES | CC=C1CC(COC)(COC)CC1(C)C |
| InChI | InChI=1S/C13H24O2/c1-6-11-7-13(9-14-4,10-15-5)8-12(11,2)3/h6H,7-10H2,1-5H3 |
| InChIKey | URSTWYWOIWZIQN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane?
The IUPAC name of 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane (CID 11441832) is 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane.
What is the SMILES notation for 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane?
The canonical SMILES for 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane is CC=C1CC(COC)(COC)CC1(C)C.
What is the InChIKey of 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane?
The InChIKey is URSTWYWOIWZIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-6-11-7-13(9-14-4,10-15-5)8-12(11,2)3/h6H,7-10H2,1-5H3.
What are the key properties of 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane?
2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane has a molecular weight of 212.33 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidene-4,4-bis(methoxymethyl)-1,1-dimethylcyclopentane is sourced from PubChem (CID 11441832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).